
CAS 106-62-7
:2-(2-Hydroxypropoxy)-1-propanol
Description:
2-(2-Hydroxypropoxy)-1-propanol, also known as propylene glycol monolaurate or by its CAS number 106-62-7, is a chemical compound characterized by its structure, which includes a hydroxyl group and ether linkages. This substance is a colorless, odorless liquid that is hygroscopic, meaning it can absorb moisture from the air. It is soluble in water and many organic solvents, making it versatile for various applications. The compound is often used as a solvent, emulsifier, and stabilizer in food, cosmetics, and pharmaceuticals. Its low toxicity profile and ability to enhance the solubility of other compounds make it a valuable ingredient in formulations. Additionally, it exhibits properties that can help improve the texture and stability of products. Due to its chemical structure, it can also participate in various chemical reactions, making it useful in synthetic organic chemistry. Overall, 2-(2-Hydroxypropoxy)-1-propanol is recognized for its functional properties and safety in consumer products.
Formula:C6H14O3
InChI:InChI=1S/C6H14O3/c1-5(8)4-9-6(2)3-7/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=DUFKCOQISQKSAV-UHFFFAOYSA-N
SMILES:C(OCC(C)O)(CO)C
Synonyms:- 2-(2-Hydroxypropoxy)-1-propanol
- 1-Propanol, 2-(2-hydroxypropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
