CAS 106-69-4: 1,2,6-Hexanetriol
Description:1,2,6-Hexanetriol, with the CAS number 106-69-4, is a triol, meaning it contains three hydroxyl (-OH) functional groups. This organic compound is characterized by its six-carbon chain, which is linear and has hydroxyl groups attached to the first, second, and sixth carbon atoms. It is a colorless, viscous liquid at room temperature and is soluble in water due to the presence of multiple hydroxyl groups, which enhance its hydrophilicity. 1,2,6-Hexanetriol is used in various applications, including as a plasticizer, solvent, and in the synthesis of other chemical compounds. Its chemical structure allows it to participate in hydrogen bonding, contributing to its physical properties such as boiling point and viscosity. Additionally, it is relatively stable under normal conditions but should be handled with care due to potential irritant properties. Overall, 1,2,6-Hexanetriol is a versatile compound with significant utility in both industrial and laboratory settings.
Formula:C6H14O3
InChI:InChI=1S/C6H14O3/c7-4-2-1-3-6(9)5-8/h6-9H,1-5H2
InChI key:InChIKey=ZWVMLYRJXORSEP-UHFFFAOYSA-N
SMILES:OCCCCC(O)CO
- Synonyms:
- (2R)-hexane-1,2,6-triol
- (2S)-hexane-1,2,6-triol
- 1,2,6-Trihydroxyhexane
- Hexane-1,2,6-Triol
- NSC 404957
