CAS 106006-79-5

9-amino-6-methyl-5,6,6a,7-tetrahydro-4H-benzo-(de)thiazolo(4,5-g)quinoline

Description:

9-amino-6-methyl-5,6,6a,7-tetrahydro-4H-benzo-(de)thiazolo(4,5-g)quinoline, with CAS number 106006-79-5, is a heterocyclic compound characterized by its complex fused ring structure, which includes both benzothiazole and quinoline moieties. This compound features an amino group at the 9-position and a methyl group at the 6-position, contributing to its unique chemical properties. The tetrahydro configuration indicates that it contains saturated carbon atoms within its ring system, which can influence its reactivity and solubility. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of nitrogen and sulfur atoms in the structure can also impart specific electronic properties, affecting how the molecule interacts with biological targets. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting various diseases. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₄H₁₅N₃S

InChI: InChI=1/C14H15N3S/c1-17-6-5-8-3-2-4-9-12(8)10(17)7-11-13(9)16-14(15)18-11/h2-4,10H,5-7H2,1H3,(H2,15,16)

SMILES: CN1CCc2cccc3c2C1Cc1c3[nH]c(=N)s1

Synonyms:

• 9-Amtbtq
• 6-methyl-5,6,6a,7-tetrahydro-4H-benzo[de][1,3]thiazolo[4,5-g]quinolin-9-amine

N-Propyl-4,5,6,7-tetrahydrobenzo[D]thiazol-6-amine

CAS: 106006-79-5

N-Propyl-4,5,6,7-tetrahydrobenzo[D]thiazol-6-amine hydrochloride is a chemical intermediate or reagent used in the synthesis of other substances. It is a white solid that is soluble in water and has a melting point of 154°C. This chemical has been shown to be useful as a building block for the synthesis of many different substances. N-Propyl-4,5,6,7-tetrahydrobenzo[D]thiazol-6-amine hydrochloride is also an effective starting material for research chemicals with versatile applications.

Formula: C₁₄H₁₅N₃S

Purity: Min. 95%

Molecular weight: 257.36 g/mol

Ref: 3D-FP65140