CAS 106006-83-1
:2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
Description:
2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a benzene ring and a thiazole moiety. This compound features two amino groups at the 2 and 6 positions of the benzothiazole framework, which significantly influences its reactivity and potential applications. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to form coordination complexes. Its properties can be further modified through substitution reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling, as with many nitrogen-containing compounds, it may pose health risks if not managed properly. Overall, 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole represents a significant compound for research and development in chemical applications.
Formula:C7H11N3S
InChI:InChI=1/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10)
InChI key:InChIKey=DRRYZHHKWSHHFT-UHFFFAOYSA-N
SMILES:NC1=NC2=C(S1)CC(N)CC2
Synonyms:- (RS)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-
- 2,6-Diamino-4,5,6,7-tetrahydro-1,3-benzothiazole
- 4,5,6,7-Tetrahydro-1,3-Benzothiazole-2,6-Diamine
- 4,5,6,7-Tetrahydro-2,6-benzothiazole diamine
- 4,5,6,7-Tetrahydro-2,6-benzothiazolediamine
- 4,5,6,7-Tetrahydro-benzothiazole-2,6-diamine
- 4,5,6,7-Tetrahydrobenzothiazole-2,6-diamine
- (±)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- 2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- ()-2,6-DIAMINO-4,5,6,7-TETRA-HYDROBENZOTHIAZOL
- (+/-)- 2,6-diamino-4,5,6,7-tetrahydrobenzothiazol
- Pramipexole Impurity 79
- Pramipexole Impurity 42
- 6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- R,S-2,6-DiaMino-4,5,6,7- tetrahydrobenzothiazole
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
