CAS 106014-16-8
:3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid
Description:
3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid, with the CAS number 106014-16-8, is an organic compound characterized by its carboxylic acid functional group and a thioether moiety. This substance features a branched structure, which contributes to its unique chemical properties. The presence of the carboxyethyl group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The thioether linkage enhances its reactivity and solubility in polar solvents, making it useful in biochemical applications. Additionally, the compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it may engage in hydrogen bonding, influencing its physical properties such as melting and boiling points. Overall, 3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C7H12O4S
InChI:InChI=1S/C7H12O4S/c1-4(6(8)9)3-12-5(2)7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11)
InChI key:InChIKey=YFXYLSSOKGLAKG-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CSC(C(O)=O)C)C
Synonyms:- 3-[(1-Carboxyethyl)sulfanyl]-2-methylpropanoic acid
- Propanoic acid, 3-[(1-carboxyethyl)thio]-2-methyl-
- 2,5-Dimethyl-3-thiaadipic acid
- 3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,5-Dimethyl-3-thiaadipic Acid
CAS:Controlled Product<p>Applications Used in the preparation of herbicides.<br></p>Formula:C7H12O4SColor and Shape:NeatMolecular weight:192.23
