CAS 106014-16-8

3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid

Description:

3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid, with the CAS number 106014-16-8, is an organic compound characterized by its carboxylic acid functional group and a thioether moiety. This substance features a branched structure, which contributes to its unique chemical properties. The presence of the carboxyethyl group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. The thioether linkage enhances its reactivity and solubility in polar solvents, making it useful in biochemical applications. Additionally, the compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it may engage in hydrogen bonding, influencing its physical properties such as melting and boiling points. Overall, 3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₁₂O₄S

InChI: InChI=1S/C7H12O4S/c1-4(6(8)9)3-12-5(2)7(10)11/h4-5H,3H2,1-2H3,(H,8,9)(H,10,11)

InChI key: InChIKey=YFXYLSSOKGLAKG-UHFFFAOYSA-N

SMILES: C(C(O)=O)(CSC(C(O)=O)C)C

Synonyms:

• 3-[(1-Carboxyethyl)sulfanyl]-2-methylpropanoic acid
• Propanoic acid, 3-[(1-carboxyethyl)thio]-2-methyl-
• 2,5-Dimethyl-3-thiaadipic acid
• 3-[(1-Carboxyethyl)thio]-2-methylpropanoic acid

2,5-Dimethyl-3-thiaadipic Acid

Controlled Product

CAS: 106014-16-8

Applications Used in the preparation of herbicides.

Formula: C₇H₁₂O₄S

Color and Shape: Neat

Molecular weight: 192.23

Ref: TR-D469600