CAS 106018-36-4
:pglu-val-asn-phe-ser-pro-gly-trp-gly-*thr amide
Description:
The chemical substance known as "pglu-val-asn-phe-ser-pro-gly-trp-gly-thr amide," with the CAS number 106018-36-4, is a peptide composed of a sequence of amino acids. This compound features a specific arrangement of amino acids, including proline (pro), glycine (gly), and tryptophan (trp), which contribute to its structural and functional properties. The presence of an amide group at the terminal end indicates that it is likely involved in biological processes, potentially acting as a signaling molecule or a component of larger protein structures. Peptides like this one can exhibit various biological activities, including hormone-like effects, modulation of immune responses, or involvement in neurotransmission. The characteristics of this peptide, such as solubility, stability, and reactivity, can be influenced by its amino acid composition and sequence. Additionally, its biological activity may be affected by post-translational modifications or interactions with other biomolecules. Overall, this peptide represents a specific sequence that may have relevance in biochemical research or therapeutic applications.
Formula:C50H67N13O14
InChI:InChI=1/C50H67N13O14/c1-25(2)41(62-45(72)31-15-16-38(67)56-31)49(76)59-34(20-37(51)66)47(74)58-32(18-27-10-5-4-6-11-27)46(73)60-35(24-64)50(77)63-17-9-14-36(63)48(75)55-22-39(68)57-33(19-28-21-53-30-13-8-7-12-29(28)30)44(71)54-23-40(69)61-42(26(3)65)43(52)70/h4-8,10-13,21,25-26,31-36,41-42,53,64-65H,9,14-20,22-24H2,1-3H3,(H2,51,66)(H2,52,70)(H,54,71)(H,55,75)(H,56,67)(H,57,68)(H,58,74)(H,59,76)(H,60,73)(H,61,69)(H,62,72)/t26-,31+,32+,33+,34+,35+,36+,41+,42+/m1/s1
Synonyms:- Hypertrehalosaemic Neuropeptide (Nauphoeta cinerea)
- Pyr-Val-Asn-Phe-Ser-Pro-Gly-Trp-Gly-Thr-NH2
- 5-oxo-L-prolyl-L-valyl-L-asparaginyl-L-phenylalanyl-L-seryl-L-prolylglycyl-L-tryptophylglycyl-L-threoninamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.