CAS 10602-01-4

4-Bromophenyldioxolane

Description:

4-Bromophenyldioxolane is an organic compound characterized by its dioxolane ring structure, which features a bromine substituent on a phenyl group. This compound typically exhibits a colorless to pale yellow appearance and is known for its aromatic properties due to the presence of the phenyl ring. The dioxolane moiety contributes to its potential as a solvent and in various chemical reactions, particularly in organic synthesis. Its bromine atom can participate in electrophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. The compound is generally stable under standard conditions but may undergo reactions such as nucleophilic substitution or elimination under specific circumstances. As with many brominated compounds, it may exhibit biological activity, which necessitates careful handling and consideration of safety protocols. Overall, 4-Bromophenyldioxolane serves as a valuable compound in both academic research and industrial applications, particularly in the fields of pharmaceuticals and materials science.

Formula: C₉H₉BrO₂

InChI: InChI=1/C9H9BrO2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4,9H,5-6H2

SMILES: c1cc(ccc1C1OCCO1)Br

Synonyms:

• 2-(4-Bromophenyl)-1,3-dioxolane

2-(4-BROMOPHENYL)-1,3-DIOXOLANE

CAS: 10602-01-4

Formula: C₉H₉BrO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 229.0706

Ref: IN-DA003EV5

2-(4-Bromophenyl)-1,3-dioxolane

CAS: 10602-01-4

2-(4-Bromophenyl)-1,3-dioxolane

Purity: 98%

Molecular weight: 229.07056g/mol

Ref: 54-OR10837

2-(4-Bromophenyl)-1,3-dioxolane

CAS: 10602-01-4

Formula: C₉H₉BrO₂

Purity: >98.0%(GC)

Color and Shape: White or Colorless to Light yellow powder to lump to clear liquid

Molecular weight: 229.07

Ref: 3B-B2100

1-Bromo-4-(1,3-dioxolan-2-yl)benzene

CAS: 10602-01-4

Formula: C₉H₉BrO₂

Purity: 96%

Color and Shape: No data available.

Molecular weight: 229.073

Ref: 10-F208279