
CAS 10602-07-0
:3-Ethynylbenzenemethanol
Description:
3-Ethynylbenzenemethanol, also known by its CAS number 10602-07-0, is an organic compound characterized by the presence of both an ethynyl group and a benzyl alcohol functional group. This compound features a phenyl ring substituted with an ethynyl group at the meta position relative to the hydroxymethyl group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethynyl group imparts unique reactivity, making it useful in various synthetic applications, particularly in organic synthesis and materials science. The hydroxymethyl group contributes to its potential as a building block in the synthesis of more complex molecules. 3-Ethynylbenzenemethanol may exhibit moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic characteristics. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H8O
InChI:InChI=1S/C9H8O/c1-2-8-4-3-5-9(6-8)7-10/h1,3-6,10H,7H2
InChI key:InChIKey=ZZIJUXAKPUSHFS-UHFFFAOYSA-N
SMILES:C(#C)C1=CC(CO)=CC=C1
Synonyms:- Benzenemethanol, 3-ethynyl-
- (3-Ethynylphenyl)methanol
- Benzyl alcohol, m-ethynyl-
- 3-Ethynylbenzenemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(3-Ethynylphenyl)methanol
CAS:(3-Ethynylphenyl)methanol is a colorless, volatile liquid with a chloroform-like odor. It is soluble in organic solvents and insoluble in water. It has a boiling point of 114°C and a melting point of -37°C. (3-Ethynylphenyl)methanol can be found as an impurity in polyester resins and polyurethane foams. This compound is also used to produce polymers such as polycondensation, polyesters, and dimethylformamide. (3-Ethynylphenyl)methanol is produced by the direct chlorination of phenol. The compound can be polymerized to form polymers that are resistant to uv light and heat, such as terephthaloyl chloride.
Formula:C9H8OPurity:Min. 95%Molecular weight:132.16 g/molRef: 3D-KAA60207
Discontinued product




