CymitQuimica logo

CAS 10602-37-6

:

1,1,3,3-tetraethoxy-2-methylpropane

Description:
1,1,3,3-Tetraethoxy-2-methylpropane is an organic compound characterized by its structure, which includes four ethoxy groups attached to a central propane backbone with a methyl substituent. This compound is typically a colorless liquid at room temperature and is known for its relatively low volatility and moderate solubility in organic solvents. Its molecular structure contributes to its properties, such as being a potential solvent or reagent in various chemical reactions. The presence of multiple ethoxy groups enhances its reactivity and ability to form complexes with metal ions, making it useful in coordination chemistry. Additionally, the compound may exhibit interesting physical properties, such as a specific boiling point and density, which can be influenced by the arrangement of its substituents. Due to its unique structure, it may also have applications in organic synthesis and materials science. However, safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H26O4
InChI:InChI=1/C12H26O4/c1-6-13-11(14-7-2)10(5)12(15-8-3)16-9-4/h10-12H,6-9H2,1-5H3
InChI key:InChIKey=XTYLJMKJLMHFJK-UHFFFAOYSA-N
SMILES:C(C(C(OCC)OCC)C)(OCC)OCC
Synonyms:
  • Malonaldehyde, methyl-, bis(diethyl acetal)
  • 1,1,3,3-Tetraethoxy-2-methylpropane
  • Methylmalonaldehyde tetraethyl diacetal
  • Propane, 1,1,3,3-tetraethoxy-2-methyl-
  • 2-Methyl-1,1,3,3-tetraethoxypropane
  • 1,1,3,3-Tetramethoxy-2-methyl propane
  • Einecs 234-225-2
Found 5 products.