CAS 106020-61-5
:2-(1-Hydroxyhexyl)cyclopentanone
Description:
2-(1-Hydroxyhexyl)cyclopentanone is an organic compound characterized by its cyclopentanone structure, which features a cyclopentane ring with a ketone functional group. The presence of a hydroxyhexyl substituent indicates that there is a hydroxyl group (-OH) attached to a hexyl chain, contributing to its potential as a hydrophilic molecule. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The molecular structure suggests it may have applications in the fragrance and flavor industry, as well as in the synthesis of other organic compounds. Additionally, the presence of both hydrophobic (the cyclopentanone ring and hexyl chain) and hydrophilic (the hydroxyl group) components may allow for interesting interactions in biological systems or materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential reactivity and toxicity.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-2-3-4-7-10(12)9-6-5-8-11(9)13/h9-10,12H,2-8H2,1H3
InChI key:InChIKey=BVJDBUQKHVIFPW-UHFFFAOYSA-N
SMILES:C(CCCCC)(O)C1C(=O)CCC1
Synonyms:- 2-(1-Hydroxyhexyl)cyclopentan-1-one
- Cyclopentanone, 2-(1-Hydroxyhexyl)-
- 2-(1-Hydroxyhexyl)cyclopentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(1-Hydroxyhexyl)cyclopentanone
CAS:Controlled ProductFormula:C11H20O2Color and Shape:NeatMolecular weight:184.275
