CymitQuimica logo

CAS 106021-42-5

:

4-(TRANS-4-PROPYLCYCLOHEXYL)-2-FLUOROBENZONITRILE

Description:
4-(Trans-4-propylcyclohexyl)-2-fluorobenzenenitrile, with the CAS number 106021-42-5, is an organic compound characterized by its unique molecular structure, which includes a fluorobenzene moiety and a propylcyclohexyl group. This compound typically exhibits properties associated with liquid crystals, making it of interest in the field of materials science, particularly for applications in display technologies. The presence of the fluorine atom can influence its electronic properties, potentially enhancing stability and solubility in various solvents. Additionally, the bulky propylcyclohexyl group contributes to the compound's steric hindrance, which can affect its phase behavior and alignment in liquid crystal applications. Its nitrile functional group may also impart specific reactivity and polarity characteristics, making it suitable for various chemical reactions. Overall, this compound's structural features suggest potential utility in advanced materials and liquid crystal displays, although specific physical and chemical properties would need to be determined experimentally.
Formula:C16H20FN
InChI:InChI=1S/C16H20FN/c1-2-3-12-4-6-13(7-5-12)14-8-9-15(11-18)16(17)10-14/h8-10,12-13H,2-7H2,1H3
InChI key:MEIZMSPIBFTTTE-UHFFFAOYSA-N
SMILES:CCCC1CCC(CC1)C2=CC(=C(C=C2)C#N)F
Found 0 products.