CAS 106024-59-3
:N-(1-Methylethyl)-1H-indole-2-methanamine
Description:
N-(1-Methylethyl)-1H-indole-2-methanamine, also known by its CAS number 106024-59-3, is a chemical compound that belongs to the class of indole derivatives. This substance features an indole ring, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring, and is substituted with a methanamine group at the 2-position and an isopropyl group at the nitrogen atom. The presence of these functional groups contributes to its unique chemical properties, including potential biological activity. The compound is typically characterized by its moderate solubility in organic solvents and may exhibit basic properties due to the amine group. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indole derivatives are often associated with various biological activities. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature reviews.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-9(2)13-8-11-7-10-5-3-4-6-12(10)14-11/h3-7,9,13-14H,8H2,1-2H3
InChI key:InChIKey=XYHLWHXETHCNAU-UHFFFAOYSA-N
SMILES:C(NC(C)C)C1=CC=2C(N1)=CC=CC2
Synonyms:- (1H-Indol-2-ylmethyl)(propan-2-yl)amine
- N-(1-Methylethyl)-1H-indole-2-methanamine
- 1H-Indole-2-methanamine, N-(1-methylethyl)-
- [(1H-Indol-2-yl)methyl](propan-2-yl)amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.