CAS 106037-36-9
:Benzamide, 4-amino-3-methyl- (9CI)
Description:
Benzamide, 4-amino-3-methyl- (9CI), with the CAS number 106037-36-9, is an organic compound characterized by its amide functional group attached to a benzene ring. It features an amino group (-NH2) at the para position and a methyl group (-CH3) at the meta position relative to the amide group on the aromatic ring. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the amine and amide functionalities. Its molecular structure contributes to its potential applications in pharmaceuticals and organic synthesis, where it may act as an intermediate or a building block for more complex molecules. The presence of both amino and methyl groups can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions.
Formula:C8H10N2O
InChI:InChI=1/C8H10N2O/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,9H2,1H3,(H2,10,11)
SMILES:Cc1cc(ccc1N)C(=O)N
Synonyms:- Benzamide, 4-Amino-3-Methyl-
- 4-Amino-3-Methylbenzamide
- 4-Amino-3-methylbenzamide?New
- 4-amino-3-methylbenzamide(SALTDATA: FREE)
- Benzamide, 4-amino-3-methyl- (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-amino-3-methylbenzamide
CAS:Formula:C8H10N2OPurity:95%Color and Shape:SolidMolecular weight:150.17784-Amino-3-methylbenzamide
CAS:<p>4-Amino-3-methylbenzamide is a pyrrole derivative that is a selective inhibitor of cytochrome P450 reductase. It has been used in clinical development as a potential therapeutic agent for asthma and other diseases associated with sensitivity to airway irritants. 4-Amino-3-methylbenzamide has been shown to inhibit the production of reactive oxygen species (ROS) from human neutrophils, which may be involved in the pathogenesis of asthma and other inflammatory diseases. The drug binds to the heme component of the reductase, blocking electron transfer and inhibiting the activity of this enzyme. As a result, it inhibits the formation of toxic ROS and protects against oxidative stress. The drug also inhibits endogenous dehydrogenases and dehydrogenases derived from bacterial sources, such as mycobacterium tuberculosis.END>></p>Formula:C8H10N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:150.18 g/mol



