CymitQuimica logo

CAS 10604-22-5

:

3-Phenylcinnoline

Description:
3-Phenylcinnoline is an organic compound characterized by its fused ring structure, which consists of a cinnoline moiety substituted with a phenyl group. This compound typically exhibits a yellow to orange crystalline appearance and is known for its aromatic properties due to the presence of multiple conjugated double bonds. The molecular structure contributes to its potential applications in various fields, including organic synthesis and materials science. 3-Phenylcinnoline may also display interesting photophysical properties, making it a candidate for studies in fluorescence and photochemistry. Its reactivity can be influenced by the presence of functional groups and the overall electronic configuration, which may allow for further derivatization. Additionally, compounds of this class may exhibit biological activity, warranting investigation for potential pharmaceutical applications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C14H10N2
InChI:InChI=1S/C14H10N2/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-16-14/h1-10H
InChI key:InChIKey=AJUMVVYEUXGKQU-UHFFFAOYSA-N
SMILES:C1(=CC2=C(N=N1)C=CC=C2)C3=CC=CC=C3
Synonyms:
  • Cinnoline, 3-phenyl-
  • 3-Phenylcinnoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.