CAS 106040-48-6
:Tribenuron
Description:
Tribenuron, with the CAS number 106040-48-6, is a selective herbicide primarily used for the control of broadleaf weeds in various crops, particularly in cereal grains. It belongs to the sulfonylurea class of herbicides, which function by inhibiting the enzyme acetolactate synthase (ALS), crucial for the synthesis of essential amino acids in plants. This inhibition leads to the cessation of growth and eventual death of the targeted weeds. Tribenuron is characterized by its high potency at low application rates, making it an effective choice for integrated weed management strategies. It is typically applied post-emergence and is known for its systemic action, allowing it to be absorbed by the foliage and translocated throughout the plant. The substance is generally considered to have low toxicity to mammals and birds, but it can pose risks to aquatic organisms, necessitating careful handling and application practices. Additionally, its environmental persistence and potential for soil mobility require monitoring to prevent unintended effects on non-target species and ecosystems.
Formula:C14H15N5O6S
InChI:InChI=1S/C14H15N5O6S/c1-8-15-12(17-13(16-8)25-3)19(2)14(22)18-26(23,24)10-7-5-4-6-9(10)11(20)21/h4-7H,1-3H3,(H,18,22)(H,20,21)
InChI key:InChIKey=BQZXUHDXIARLEO-UHFFFAOYSA-N
SMILES:S(NC(N(C)C=1N=C(OC)N=C(C)N1)=O)(=O)(=O)C2=C(C(O)=O)C=CC=C2
Synonyms:- 2-[4-Methoxy-6-Methyl-1,3,5-Triazin-2-Yl(Methyl)Carbamoylsulfamoyl]Benzoic Acid
- 2-[[[[(4-Methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]benzoic acid
- 2-{[(4-Methoxy-6-Methyl-1,3,5-Triazin-2-Yl)(Methyl)Carbamoyl]Sulfamoyl}Benzoic Acid
- Benzoic acid, 2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)methylamino]carbonyl]amino]sulfonyl]-
- Tribenuron
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tribenuron
CAS:Controlled Product<p>Applications Tribenuron is an herbicide used in the protection of grains and produce crops.<br>References Nazari A. et al.: Int J. Agri. Crop Sci., 5, 449 (2013);<br></p>Formula:C14H15N5O6SColor and Shape:NeatMolecular weight:381.36Tribenuron
CAS:Tribenuron is a medicinal compound that has been traditionally used in Chinese medicine for its anticancer properties. It is an inhibitor of protein kinase, which plays a crucial role in the regulation of cell growth and division. Tribenuron has been shown to induce apoptosis, or programmed cell death, in cancer cells by inhibiting the activity of certain proteins involved in tumor growth. Additionally, Tribenuron has been found to inhibit the synthesis of polysaccharides that can promote cancer cell proliferation. Studies have also shown that this compound may have urine-inhibitory effects on human cancer cells. Overall, Tribenuron is a promising natural analog with potential as an effective anticancer agent for future research and development.Formula:C14H15N5O6SPurity:Min. 95%Molecular weight:381.37 g/molTribenuron
CAS:<p>Tribenuron, a slow acting sulfonylurea herbicide, controls broadleaf weed.</p>Formula:C14H15N5O6SColor and Shape:SolidMolecular weight:381.36




