CAS 10605-02-4
:Palmatine chloride
Description:
Palmatine chloride, with the CAS number 10605-02-4, is a quaternary ammonium salt derived from palmatine, a natural alkaloid found in various plant species. This compound typically appears as a white to off-white crystalline solid and is known for its solubility in water and organic solvents. Palmatine chloride exhibits antimicrobial properties, making it of interest in pharmaceutical and cosmetic applications. Its structure features a long hydrocarbon chain, which contributes to its surfactant properties, allowing it to interact with biological membranes. Additionally, palmatine chloride may have potential therapeutic effects, including anti-inflammatory and antioxidant activities. However, like many quaternary ammonium compounds, it should be handled with care due to potential toxicity and irritant effects on skin and mucous membranes. Overall, palmatine chloride is a versatile compound with applications in various fields, including medicine, agriculture, and materials science, warranting further research into its properties and potential uses.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12,17H,7-8H2,1-4H3
SMILES:COc1ccc2=CC3c4cc(c(cc4CCN3C=c2c1OC)OC)OC
Synonyms:- 2,3,9,10-Tetramethoxyprotoberberinchloride
- Berbericine Chloride
- Palmatine Hydrochloride
- Palmatine HCL
- 2,3,9,10-Tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride
- 2,3,9,10-Tetramethoxy-5,6-Dihydroisoquino[3,2-A]Isoquinolinium Chloride
- 2,3,9,10-tetramethoxy-5,13a-dihydro-6H-isoquino[3,2-a]isoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 14 products.
Palmatine Chloride
CAS:Formula:C21H22ClNO4Purity:>97.0%(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:387.86Palmatine chloride
CAS:Palmatine chloride analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C21H22NO4ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:387.84Palmatine chloride
CAS:Palmatine chlorideFormula:C21H22ClNO4Purity:83.7%Color and Shape:YellowMolecular weight:387.12374Palmatine Chloride
CAS:Vegetable alkaloids, natural or reproduced by synthesis, their salts and other derivatives, nesoiFormula:C21H22ClNO4Color and Shape:Orange PowderMolecular weight:387.12374Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, chloride
CAS:Formula:C21H22ClNO4Purity:97%Color and Shape:SolidMolecular weight:387.8567Palmatine Chloride
CAS:Palmatine hydrochloride (PaH), a naturally occurring photosensitizer isolated from traditional Chinese medicine (TCM), can induce remarkable cell apoptosis ,significantly increase intracellular ROS level and significantly kill breast cancer MCF-7 cells; it also has potential in photodynamic therapy on colon adenocarcinoma.[1,2]Formula:C21H22ClNO4Purity:95%~99%Color and Shape:White powderMolecular weight:387.86Palmatine chloride
CAS:Palmatine chloride an isoquinoline alkaloid, is an important medicinal herbal extract with diverse pharmacological and biological properties.Formula:C21H22ClNO4Purity:97.9% - 99.47%Color and Shape:SolidMolecular weight:387.86Palmatine chloride
CAS:Natural alkaloidFormula:C21H22NO4ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:387.86Palmatine Chloride
CAS:Controlled ProductApplications Palmatine Chloride is a protoberberine alkaloid, as a potential anti-inflammatory and anti-hypertensive agent.
References Bhadra, K. et al.: Med. Res. Rev., 31, 821 (2011)Formula:C21H22NO4·ClColor and Shape:NeatMolecular weight:387.86Palmatine chloride
CAS:Palmatine chloride is an alkaloid that has been isolated from the roots of Corydalis yanhusuo. Palmatine chloride inhibits the activity of toll-like receptor 4, which is a key molecule in inflammation and autoimmunity. This compound also inhibits the synthesis of proinflammatory cytokines such as IL-1β, IL-6, and TNF-α. Palmatine chloride has also been shown to inhibit the production of inflammatory mediators such as nitric oxide (NO) and prostaglandin E2 (PGE2). Furthermore, palmatine chloride has been found to have anti-cancer properties through its inhibition of squamous cell carcinoma cells.
Formula:C21H22NO4ClPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:387.86 g/molRef: 3D-FP73849
Discontinued product
![Dibenzo[a,g]quinolizinium, 5,6-dihydro-2,3,9,10-tetramethoxy-, chloride](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA00HAQQ.jpg&w=3840&q=75)
