CymitQuimica logo

CAS 106060-96-2

:

2,3-Diethyl-5,6-dimethylpyrazine

Description:
2,3-Diethyl-5,6-dimethylpyrazine is an organic compound belonging to the pyrazine family, characterized by its distinct aromatic properties. It features a pyrazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at the 1 and 4 positions. The presence of ethyl and methyl substituents at the 2, 3, 5, and 6 positions contributes to its unique chemical behavior and potential applications. This compound is typically colorless to pale yellow and may have a strong, distinctive odor, often described as nutty or roasted, which makes it of interest in flavor and fragrance industries. Its molecular structure allows for various interactions, making it a candidate for studies in organic synthesis and material science. Additionally, 2,3-Diethyl-5,6-dimethylpyrazine may exhibit biological activity, although specific pharmacological properties would require further investigation. As with many organic compounds, safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c1-5-9-10(6-2)12-8(4)7(3)11-9/h5-6H2,1-4H3
InChI key:InChIKey=YAGSHZPMYHTMPZ-UHFFFAOYSA-N
SMILES:C(C)C=1C(CC)=NC(C)=C(C)N1
Synonyms:
  • 2,3-Diethyl-5,6-dimethylpyrazine
  • Pyrazine, 2,3-diethyl-5,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.