CymitQuimica logo

CAS 1060717-89-6

:

5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-acetonitrile

Description:
5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-acetonitrile is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of a methoxy group (-OCH3) at the 5-position contributes to its unique chemical properties, potentially influencing its reactivity and solubility. The acetonitrile group at the 3-position introduces a nitrile functional group, which is known for its polar characteristics and ability to participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's stability, solubility in organic solvents, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many heterocycles, it may also display interesting electronic properties due to the conjugated system within its structure.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c1-14-9-3-2-8-10(13-9)7(4-5-11)6-12-8/h2-3,6,12H,4H2,1H3
InChI key:InChIKey=OWQRZPQIDWUQKR-UHFFFAOYSA-N
SMILES:C(C#N)C=1C=2C(NC1)=CC=C(OC)N2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine-3-acetonitrile, 5-methoxy-
  • 5-Methoxy-1H-pyrrolo[3,2-b]pyridine-3-acetonitrile
  • 2-[5-Methoxy-1H-pyrrolo[3,2-b]pyridin-3-yl]acetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.