CAS 106073-17-0
:3-cyano-3,4-dihydroquinoline-2(1H)-one
Description:
3-Cyano-3,4-dihydroquinoline-2(1H)-one, with the CAS number 106073-17-0, is a heterocyclic organic compound characterized by its quinoline structure, which features a fused bicyclic system containing both a benzene and a pyridine ring. This compound contains a cyano group (-CN) and a carbonyl group (C=O) as part of its molecular framework, contributing to its reactivity and potential applications in various chemical reactions. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the cyano group enhances its ability to participate in nucleophilic addition reactions, making it a valuable intermediate in organic synthesis. Additionally, compounds of this class may exhibit biological activity, which has drawn interest in medicinal chemistry for potential therapeutic applications. Its unique structural features and functional groups make it a subject of study for researchers exploring new chemical entities and their properties.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13/h1-4,8H,5H2,(H,12,13)
SMILES:c1ccc2c(c1)CC(C#N)C(=N2)O
Synonyms:- 1,2,3,4-Tetrahydro-2-oxo-3-quinolinecarbonitrile
- Brn 4678758
- Compound 84-182
- 3-Quinolinecarbonitrile, 1,2,3,4-tetrahydro-2-oxo-
- 2-Oxo-1,2,3,4-Tetrahydroquinoline-3-Carbonitrile
- 3-Cyano-3,4-dihydroquinoline-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.