CymitQuimica logo

CAS 1060801-08-2

:

2-Cyano-4-pyridinesulfonyl chloride

Description:
2-Cyano-4-pyridinesulfonyl chloride is a chemical compound characterized by its pyridine ring, which is substituted with both a cyano group and a sulfonyl chloride group. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. The cyano group contributes to the compound's polarity and can influence its solubility in various solvents. It is often utilized in organic synthesis, particularly in the preparation of sulfonamide derivatives and other nitrogen-containing compounds. The compound's reactivity makes it valuable in medicinal chemistry and the development of pharmaceuticals. Safety precautions are necessary when handling this substance, as it can be corrosive and may release toxic gases upon decomposition. Proper storage conditions, typically in a cool, dry place away from moisture, are essential to maintain its stability.
Formula:C6H3ClN2O2S
InChI:InChI=1S/C6H3ClN2O2S/c7-12(10,11)6-1-2-9-5(3-6)4-8/h1-3H
InChI key:InChIKey=UPBBLDGJDZSZIH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C(C#N)N=CC1
Synonyms:
  • 4-Pyridinesulfonyl chloride, 2-cyano-
  • 2-Cyano-4-pyridinesulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.