
CAS 1060801-22-0
:2-Bromo-6-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid
Description:
2-Bromo-6-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and an amino acid derivative. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a protective group commonly used in organic synthesis, particularly in the context of amino acids. This compound is likely to exhibit properties typical of pyridine derivatives, such as moderate polarity and potential for hydrogen bonding due to the carboxylic acid functional group. Its bromine substituent may impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The compound's solubility is expected to vary depending on the solvent, with polar solvents likely facilitating better solubility due to the presence of the carboxylic acid. Overall, this compound may find applications in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C11H13BrN2O4
InChI:InChI=1S/C11H13BrN2O4/c1-11(2,3)18-10(17)14-8-5-6(9(15)16)4-7(12)13-8/h4-5H,1-3H3,(H,15,16)(H,13,14,17)
InChI key:InChIKey=RPNYICAMDDIVAT-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=CC(C(O)=O)=CC(Br)=N1
Synonyms:- 2-Bromo-6-[[(1,1-dimethylethoxy)carbonyl]amino]-4-pyridinecarboxylic acid
- 4-Pyridinecarboxylic acid, 2-bromo-6-[[(1,1-dimethylethoxy)carbonyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.