CymitQuimica logo

CAS 1060801-34-4

:

1-(6-Amino-3-pyridinyl)-2,2,2-trifluoroethanone

Description:
1-(6-Amino-3-pyridinyl)-2,2,2-trifluoroethanone, identified by its CAS number 1060801-34-4, is an organic compound characterized by the presence of a pyridine ring substituted with an amino group and a trifluoroethanone moiety. This compound typically exhibits properties associated with both its aromatic and functional groups, including potential polar characteristics due to the amino group and the electronegative trifluoromethyl group. The trifluoroethanone part contributes to its reactivity, particularly in nucleophilic addition reactions. The presence of the amino group may enhance its solubility in polar solvents and allow for hydrogen bonding interactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H5F3N2O
InChI:InChI=1S/C7H5F3N2O/c8-7(9,10)6(13)4-1-2-5(11)12-3-4/h1-3H,(H2,11,12)
InChI key:InChIKey=BKGUBYAOWOUGIL-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C=CC(N)=NC1
Synonyms:
  • Ethanone, 1-(6-amino-3-pyridinyl)-2,2,2-trifluoro-
  • 1-(6-Amino-3-pyridinyl)-2,2,2-trifluoroethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.