CAS 1060801-41-3

2-Pyridinamine, 3-chloro-N,N-dimethyl-

Description:

2-Pyridinamine, 3-chloro-N,N-dimethyl- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro substituent at the 3-position and dimethylamino groups at the 2-position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Additionally, the presence of the dimethylamino group can influence its basicity and overall reactivity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Pyridinamine, 3-chloro-N,N-dimethyl- is a compound of interest in both academic research and potential industrial applications.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-10(2)7-6(8)4-3-5-9-7/h3-5H,1-2H3

InChI key: InChIKey=SZXYDWPYZUCOSY-UHFFFAOYSA-N

SMILES: N(C)(C)C1=C(Cl)C=CC=N1

Synonyms:

• 3-Chloro-n,n-dimethylpyridin-2-amine
• 2-Pyridinamine, 3-chloro-N,N-dimethyl-