CAS 1060801-43-5
:6-(Dimethylamino)-2-pyridinemethanamine
Description:
6-(Dimethylamino)-2-pyridinemethanamine, with the CAS number 1060801-43-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a dimethylamino group, which contributes to its basicity and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the amino group suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its solubility in polar solvents indicates that it can interact with biological systems effectively. Safety data should be consulted for handling and storage, as compounds with amine functionalities can be sensitive to air and moisture, potentially leading to degradation or reaction with other substances. Overall, 6-(Dimethylamino)-2-pyridinemethanamine is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c1-11(2)8-5-3-4-7(6-9)10-8/h3-5H,6,9H2,1-2H3
InChI key:InChIKey=WSDSLOJOKKCEHE-UHFFFAOYSA-N
SMILES:N(C)(C)C=1N=C(CN)C=CC1
Synonyms:- 6-(Aminomethyl)-N,N-dimethylpyridin-2-amine
- 2-Pyridinemethanamine, 6-(dimethylamino)-
- 6-(Dimethylamino)-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
