CAS 1060801-44-6

1-[6-(Dimethylamino)-2-pyridinyl]ethanone

Description:

1-[6-(Dimethylamino)-2-pyridinyl]ethanone, identified by its CAS number 1060801-44-6, is an organic compound characterized by its pyridine ring and a ketone functional group. This substance features a dimethylamino group, which contributes to its basicity and potential reactivity. The presence of the pyridine moiety suggests that it may exhibit aromatic properties, influencing its stability and reactivity in various chemical environments. Typically, compounds like this can participate in nucleophilic substitutions and may act as ligands in coordination chemistry. The ketone functional group indicates that it can undergo typical carbonyl reactions, such as nucleophilic addition. Additionally, the dimethylamino group can enhance solubility in polar solvents and may influence biological activity, making it of interest in pharmaceutical research. Overall, the compound's structure suggests a range of potential applications in organic synthesis and medicinal chemistry, although specific properties such as melting point, boiling point, and solubility would need to be determined through experimental data.

Formula: C₉H₁₂N₂O

InChI: InChI=1S/C9H12N2O/c1-7(12)8-5-4-6-9(10-8)11(2)3/h4-6H,1-3H3

InChI key: InChIKey=PCMOGBBTPXHZRK-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1N=C(N(C)C)C=CC1

Synonyms:

• 1-[6-(Dimethylamino)-2-pyridinyl]ethanone
• Ethanone, 1-[6-(dimethylamino)-2-pyridinyl]-