CAS 1060801-71-9

3-(Chloromethyl)-5-methoxypyridine

Description:

3-(Chloromethyl)-5-methoxypyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloromethyl group at the 3-position and a methoxy group at the 5-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The chloromethyl group can serve as a reactive site for further functionalization, while the methoxy group can influence the electronic properties of the molecule, affecting its reactivity and interaction with other substances. Due to these characteristics, 3-(Chloromethyl)-5-methoxypyridine may find applications in pharmaceuticals, agrochemicals, and materials science. As with all chemical substances, proper handling and safety precautions should be observed, given its potential hazards.

Formula: C₇H₈ClNO

InChI: InChI=1S/C7H8ClNO/c1-10-7-2-6(3-8)4-9-5-7/h2,4-5H,3H2,1H3

InChI key: InChIKey=FMZJIXNDAVBBIK-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=C(OC)C=NC1

Synonyms:

• 3-(Chloromethyl)-5-methoxypyridine
• Pyridine, 3-(chloromethyl)-5-methoxy-