
CAS 1060801-74-2
:2,2,2-Trifluoro-1-(5-methoxy-2-pyridinyl)ethanone
Description:
2,2,2-Trifluoro-1-(5-methoxy-2-pyridinyl)ethanone, with the CAS number 1060801-74-2, is a synthetic organic compound characterized by its unique trifluoroacetyl and pyridine functionalities. This compound features a trifluoroethyl group, which imparts significant electronegativity and lipophilicity, enhancing its potential as a pharmaceutical intermediate or agrochemical. The presence of the methoxy group on the pyridine ring contributes to its solubility in organic solvents and may influence its biological activity. The compound's structure suggests it may exhibit interesting reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can stabilize certain reaction intermediates. Additionally, the pyridine moiety may participate in coordination with metal ions or interact with biological targets, making it a candidate for further research in medicinal chemistry. Overall, 2,2,2-Trifluoro-1-(5-methoxy-2-pyridinyl)ethanone is notable for its potential applications in various chemical and pharmaceutical contexts, driven by its distinctive structural features.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-14-5-2-3-6(12-4-5)7(13)8(9,10)11/h2-4H,1H3
InChI key:InChIKey=JPUCUYHOYQWRNG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC=C(OC)C=N1
Synonyms:- Ethanone, 2,2,2-trifluoro-1-(5-methoxy-2-pyridinyl)-
- 2,2,2-Trifluoro-1-(5-methoxy-2-pyridinyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.