
CAS 1060801-80-0
:2,2,2-Trifluoro-1-(3-methoxy-4-pyridinyl)ethanone
Description:
2,2,2-Trifluoro-1-(3-methoxy-4-pyridinyl)ethanone is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a pyridine moiety. The presence of three fluorine atoms contributes to its high electronegativity and lipophilicity, influencing its reactivity and solubility in organic solvents. The methoxy group attached to the pyridine ring enhances its potential for hydrogen bonding and can affect its biological activity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure suggests potential applications in medicinal chemistry, where modifications can lead to compounds with desired pharmacological properties. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioavailability, making such compounds of interest in drug design. Safety data should be consulted for handling and exposure, as fluorinated compounds can exhibit unique toxicological profiles. Overall, 2,2,2-Trifluoro-1-(3-methoxy-4-pyridinyl)ethanone represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-14-6-4-12-3-2-5(6)7(13)8(9,10)11/h2-4H,1H3
InChI key:InChIKey=TZNBLUUNLUAQBU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C(OC)=CN=CC1
Synonyms:- 2,2,2-Trifluoro-1-(3-methoxy-4-pyridinyl)ethanone
- Ethanone, 2,2,2-trifluoro-1-(3-methoxy-4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.