CAS 1060801-85-5
:5-Methoxypyridine-3-sulfonyl chloride
Description:
5-Methoxypyridine-3-sulfonyl chloride is an organic compound characterized by the presence of a pyridine ring substituted with a methoxy group and a sulfonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. The methoxy group enhances its solubility in organic solvents and can influence its electronic properties. Additionally, this compound may exhibit moderate toxicity, necessitating appropriate safety precautions during handling. Its applications often extend to the development of sulfonamide derivatives and other functionalized pyridine compounds, highlighting its significance in synthetic organic chemistry. As with many sulfonyl chlorides, it is sensitive to moisture and should be stored in a dry environment to prevent hydrolysis.
Formula:C6H6ClNO3S
InChI:InChI=1S/C6H6ClNO3S/c1-11-5-2-6(4-8-3-5)12(7,9)10/h2-4H,1H3
SMILES:COc1cc(cnc1)S(=O)(=O)Cl
Synonyms:- 5-Methoxy-3-pyridinesulfonyl chloride
- 3-Pyridinesulfonyl chloride, 5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.