CAS 1060801-91-3
:3-(Trifluoromethyl)-4-pyridinemethanamine
Description:
3-(Trifluoromethyl)-4-pyridinemethanamine, identified by its CAS number 1060801-91-3, is an organic compound characterized by the presence of a pyridine ring substituted with a trifluoromethyl group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential basicity due to the amine group. The trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and interaction with biological systems. The presence of the pyridine ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 3-(Trifluoromethyl)-4-pyridinemethanamine is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C7H7F3N2
InChI:InChI=1S/C7H7F3N2/c8-7(9,10)6-4-12-2-1-5(6)3-11/h1-2,4H,3,11H2
InChI key:InChIKey=SHQZCVNMYKUWJM-UHFFFAOYSA-N
SMILES:C(N)C=1C(C(F)(F)F)=CN=CC1
Synonyms:- [3-(Trifluoromethyl)pyridin-4-yl]methanamine
- 1-[3-(Trifluoromethyl)pyridin-4-yl]methanamine
- 3-(Trifluoromethyl)-4-pyridinemethanamine
- 4-Pyridinemethanamine, 3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.