CAS 1060801-94-6
:3-(Chloromethyl)-5-(trifluoromethyl)pyridine
Description:
3-(Chloromethyl)-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both a chloromethyl group and a trifluoromethyl group. The chloromethyl group introduces a reactive site that can participate in further chemical reactions, making the compound useful in various synthetic applications. The trifluoromethyl group significantly enhances the lipophilicity and stability of the molecule, often imparting unique electronic properties that can influence its reactivity and interactions with biological systems. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. Its applications may include use in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of chlorine and fluorine atoms, which can be toxic or environmentally hazardous.
Formula:C7H5ClF3N
InChI:InChI=1S/C7H5ClF3N/c8-2-5-1-6(4-12-3-5)7(9,10)11/h1,3-4H,2H2
InChI key:InChIKey=FNFXQMYVQISKRZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CCl)C=NC1
Synonyms:- 3-(Chloromethyl)-5-(trifluoromethyl)pyridine
- Pyridine, 3-(chloromethyl)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.