
CAS 1060801-96-8
:N-Methyl-5-(trifluoromethyl)-3-pyridinemethanamine
Description:
N-Methyl-5-(trifluoromethyl)-3-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 5-position of the pyridine ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The N-methyl group attached to the amine contributes to the compound's basicity and solubility in organic solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in various therapeutic contexts. Additionally, the trifluoromethyl group is known to impart unique electronic characteristics, which can influence reactivity and stability. Overall, N-Methyl-5-(trifluoromethyl)-3-pyridinemethanamine is a compound with notable structural features that may have implications in both synthetic and applied chemistry.
Formula:C8H9F3N2
InChI:InChI=1S/C8H9F3N2/c1-12-3-6-2-7(5-13-4-6)8(9,10)11/h2,4-5,12H,3H2,1H3
InChI key:InChIKey=VGMWDLVTVGODJL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(CNC)C=NC1
Synonyms:- N-Methyl-5-(trifluoromethyl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, N-methyl-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.