CAS 1060802-04-1

4,5-Dichloro-2-pyridinecarboxaldehyde

Description:

4,5-Dichloro-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. This compound features two chlorine atoms substituted at the 4 and 5 positions of the pyridine ring, along with an aldehyde functional group (-CHO) at the 2-position. The presence of the aldehyde group makes it a reactive species, capable of participating in various chemical reactions, such as nucleophilic additions and condensation reactions. The dichloro substitution enhances its electrophilic character, making it useful in synthetic organic chemistry. This compound is typically a pale yellow to brown solid or liquid, depending on its purity and specific conditions. It is soluble in organic solvents, and its reactivity allows it to be utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorinated nature and potential toxicity.

Formula: C₆H₃Cl₂NO

InChI: InChI=1S/C6H3Cl2NO/c7-5-1-4(3-10)9-2-6(5)8/h1-3H

InChI key: InChIKey=ONVAALUCQNVWNQ-UHFFFAOYSA-N

SMILES: C(=O)C1=CC(Cl)=C(Cl)C=N1

Synonyms:

• 4,5-Dichloro-2-pyridinecarboxaldehyde
• 2-Pyridinecarboxaldehyde, 4,5-dichloro-