CAS 1060802-14-3

5-Chloro-3-pyridineethanamine

Description:

5-Chloro-3-pyridineethanamine, identified by its CAS number 1060802-14-3, is an organic compound featuring a pyridine ring substituted with a chloro group and an ethylamine side chain. This compound typically exhibits characteristics common to amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the chloro substituent can also affect its reactivity, potentially making it a useful intermediate in organic synthesis or pharmaceutical applications. The pyridine ring contributes to the compound's aromaticity, which can impact its electronic properties and stability. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and specific reactivity, would depend on the molecular structure and the environment in which it is studied. Overall, 5-Chloro-3-pyridineethanamine is a compound of interest in various chemical and pharmaceutical contexts due to its unique structural features.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c8-7-3-6(1-2-9)4-10-5-7/h3-5H,1-2,9H2

InChI key: InChIKey=ZUIWNFMMKQJNOY-UHFFFAOYSA-N

SMILES: C(CN)C=1C=C(Cl)C=NC1

Synonyms:

• 2-(5-Chloropyridin-3-yl)ethan-1-amine
• 2-(5-Chloropyridin-3-yl)ethanamine
• 3-Pyridineethanamine, 5-chloro-
• 5-Chloro-3-pyridineethanamine