
CAS 1060802-20-1
:5-Bromo-4-chloro-2-pyridinecarboxaldehyde
Description:
5-Bromo-4-chloro-2-pyridinecarboxaldehyde is an organic compound characterized by its heterocyclic structure, which includes a pyridine ring substituted with both bromine and chlorine atoms, as well as an aldehyde functional group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the bromine and chlorine substituents contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde group is reactive, allowing for further functionalization and participation in condensation reactions. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure and substituents can influence its physical properties, such as melting point and boiling point, as well as its spectral characteristics, which can be analyzed using techniques like NMR and IR spectroscopy. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H3BrClNO
InChI:InChI=1S/C6H3BrClNO/c7-5-2-9-4(3-10)1-6(5)8/h1-3H
InChI key:InChIKey=XXGOLPPVOQYOLK-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(Cl)=C(Br)C=N1
Synonyms:- 2-Pyridinecarboxaldehyde, 5-bromo-4-chloro-
- 5-Bromo-4-chloro-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.