CAS 1060802-23-4

5-Bromo-2-chloroisonicotinaldehyde

Description:

5-Bromo-2-chloroisonicotinaldehyde is a chemical compound characterized by its heterocyclic structure, which includes a pyridine ring with both bromine and chlorine substituents. This compound features an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of halogens, specifically bromine and chlorine, often enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the isonicotinaldehyde framework suggests potential biological activity, as derivatives of isonicotinamides are known for their pharmacological properties. The compound's solubility and stability can vary depending on the solvent and conditions, which is crucial for its application in laboratory settings. Overall, 5-Bromo-2-chloroisonicotinaldehyde is a valuable intermediate in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₆H₃BrClNO

InChI: InChI=1S/C6H3BrClNO/c7-5-2-9-6(8)1-4(5)3-10/h1-3H

SMILES: c1c(C=O)c(cnc1Cl)Br

Synonyms:

• 5-Bromo-2-chloropyridine-4-carboxaldehyde
• 5-Bromo-2-chloropyridine-4-carbaldehyde
• 5-Bromo-2-chloro-4-pyridinecarboxaldehyde

5-Bromo-2-chloroisonicotinaldehyde

CAS: 1060802-23-4

Formula: C₆H₃BrClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.4511

Ref: IN-DA007E4Z

5-Bromo-2-chloropyridine-4-carbaldehyde

CAS: 1060802-23-4

5-Bromo-2-chloropyridine-4-carbaldehyde

Formula: C₆H₃BrClNO

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 220.45g/mol

Ref: 54-OR303267

5-Bromo-2-chloroisonicotinaldehyde

CAS: 1060802-23-4

Formula: C₆H₃BrClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.45

Ref: 10-F217610

5-Bromo-2-chloropyridine-4-carboxaldehyde

CAS: 1060802-23-4

Versatile small molecule scaffold

Formula: C₆H₃BrClNO

Purity: Min. 95%

Molecular weight: 220.45 g/mol

Ref: 3D-KSB80223