CAS 1060802-26-7

3-Bromo-4-(chloromethyl)pyridine

Description:

3-Bromo-4-(chloromethyl)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both bromine and chloromethyl groups. The bromine atom is located at the 3-position, while the chloromethyl group is attached at the 4-position of the pyridine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity due to the presence of halogen substituents, which can participate in various nucleophilic substitution reactions. The compound is of interest in organic synthesis and medicinal chemistry, as it can serve as an intermediate in the preparation of more complex molecules. Additionally, its unique structure may impart specific biological activities, making it a candidate for further research in pharmacology. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature.

Formula: C₆H₅BrClN

InChI: InChI=1S/C6H5BrClN/c7-6-4-9-2-1-5(6)3-8/h1-2,4H,3H2

InChI key: InChIKey=VXINHFGHWYFFSP-UHFFFAOYSA-N

SMILES: C(Cl)C=1C(Br)=CN=CC1

Synonyms:

• Pyridine, 3-bromo-4-(chloromethyl)-
• 3-Bromo-4-(chloromethyl)pyridine