CAS 1060802-27-8

1-(3-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone

Description:

1-(3-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a trifluoroethanone moiety. This compound typically exhibits properties associated with both halogenated and aromatic compounds, such as increased reactivity due to the presence of the bromine atom and the electron-withdrawing trifluoromethyl group. The trifluoroethanone functional group contributes to its potential as a reactive electrophile in various chemical reactions, including nucleophilic attacks. Additionally, the presence of the pyridine ring may impart basicity and influence solubility in polar solvents. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 1-(3-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone is a versatile compound with significant implications in various chemical fields.

Formula: C₇H₃BrF₃NO

InChI: InChI=1S/C7H3BrF3NO/c8-4-2-1-3-12-5(4)6(13)7(9,10)11/h1-3H

InChI key: InChIKey=MQTKTYDZUIFTII-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C1=C(Br)C=CC=N1

Synonyms:

• Ethanone, 1-(3-bromo-2-pyridinyl)-2,2,2-trifluoro-
• 1-(3-Bromo-2-pyridinyl)-2,2,2-trifluoroethanone