CAS 1060802-35-8

4-Chloro-5-fluoro-2-pyridinecarboxylic acid

Description:

4-Chloro-5-fluoro-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features both a carboxylic acid functional group and halogen substituents, specifically chlorine and fluorine, at the 4 and 5 positions of the pyridine ring, respectively. The presence of these halogens can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this exhibit moderate to high polarity due to the carboxylic acid group, which can engage in hydrogen bonding. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of halogens may enhance the compound's stability and alter its electronic properties, making it of interest in various chemical research fields. Safety data should be consulted for handling, as halogenated compounds can pose specific health and environmental risks.

Formula: C₆H₃ClFNO₂

InChI: InChI=1S/C6H3ClFNO2/c7-3-1-5(6(10)11)9-2-4(3)8/h1-2H,(H,10,11)

InChI key: InChIKey=YSOAEDBOBCTWJB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(Cl)=C(F)C=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 4-chloro-5-fluoro-
• 4-Chloro-5-fluoro-2-pyridinecarboxylic acid