
CAS 1060802-58-5
:4-Chloro-6-formyl-3-pyridinecarbonitrile
Description:
4-Chloro-6-formyl-3-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a formyl group (-CHO) at the 6-position and a cyano group (-CN) at the 3-position contributes to its reactivity and potential applications in organic synthesis. The chlorine substituent at the 4-position enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. The presence of multiple functional groups allows for diverse reactivity, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H3ClN2O
InChI:InChI=1S/C7H3ClN2O/c8-7-1-6(4-11)10-3-5(7)2-9/h1,3-4H
InChI key:InChIKey=GFJXZSFOAKDRDB-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(Cl)=C(C#N)C=N1
Synonyms:- 3-Pyridinecarbonitrile, 4-chloro-6-formyl-
- 4-Chloro-6-formyl-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.