CAS 1060802-60-9

4-(Chloromethyl)-3-pyridinecarbonitrile

Description:

4-(Chloromethyl)-3-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloromethyl group (-CH2Cl) at the 4-position and a cyano group (-C≡N) at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar organic solvents, which enhances its utility in various chemical reactions. The chloromethyl group can participate in nucleophilic substitution reactions, while the cyano group can serve as a versatile functional group for further transformations. Due to its structural features, 4-(Chloromethyl)-3-pyridinecarbonitrile may be of interest in medicinal chemistry and the development of agrochemicals, as it can act as a building block for more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature.

Formula: C₇H₅ClN₂

InChI: InChI=1S/C7H5ClN2/c8-3-6-1-2-10-5-7(6)4-9/h1-2,5H,3H2

InChI key: InChIKey=XMGVMOVUVZVEJU-UHFFFAOYSA-N

SMILES: C(Cl)C=1C(C#N)=CN=CC1

Synonyms:

• 4-(Chloromethyl)-3-pyridinecarbonitrile
• 3-Pyridinecarbonitrile, 4-(chloromethyl)-