
CAS 1060802-66-5
:2-(2,2,2-Trifluoroacetyl)-3-pyridinecarbonitrile
Description:
2-(2,2,2-Trifluoroacetyl)-3-pyridinecarbonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both a trifluoroacetyl group and a cyano group. This compound typically exhibits properties associated with both aromatic and polar functionalities due to the presence of the pyridine moiety and the electron-withdrawing trifluoroacetyl group. The trifluoromethyl group enhances the compound's lipophilicity and may influence its reactivity and solubility in organic solvents. Additionally, the cyano group contributes to the compound's potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of multiple electronegative atoms can also affect the compound's hydrogen bonding capabilities and overall stability. Overall, 2-(2,2,2-Trifluoroacetyl)-3-pyridinecarbonitrile is notable for its potential applications in various chemical reactions and its role in the synthesis of more complex molecules.
Formula:C8H3F3N2O
InChI:InChI=1S/C8H3F3N2O/c9-8(10,11)7(14)6-5(4-12)2-1-3-13-6/h1-3H
InChI key:InChIKey=DMFYTBVBQULMNU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(C#N)C=CC=N1
Synonyms:- 2-(2,2,2-Trifluoroacetyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 2-(2,2,2-trifluoroacetyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.