CAS 1060802-95-0

6-Nitro-1H-pyrrolo[2,3-b]pyridine

Description:

6-Nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 6-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability under standard laboratory conditions is notable, although it should be handled with care due to the presence of the nitro group, which can be sensitive to reduction. Overall, 6-Nitro-1H-pyrrolo[2,3-b]pyridine is an important compound in the field of organic chemistry, with implications in drug discovery and development.

Formula: C₇H₅N₃O₂

InChI: InChI=1S/C7H5N3O2/c11-10(12)6-2-1-5-3-4-8-7(5)9-6/h1-4H,(H,8,9)

InChI key: InChIKey=PPRYSAUYXNANHF-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N=C2C(=CC1)C=CN2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 6-nitro-
• 6-Nitro-1H-pyrrolo[2,3-b]pyridine