
CAS 1060803-16-8
:2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
Description:
2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyridine and a pyrrole moiety. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be exploited in various chemical reactions. Its unique structure may impart interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions. Overall, 2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde is notable for its potential applications in pharmaceuticals and organic synthesis, driven by its distinctive chemical properties.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c11-5-6-3-7-1-2-9-8(7)10-4-6/h3-5H,1-2H2,(H,9,10)
InChI key:InChIKey=WDCDJISBMKFULP-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C2C(=NC1)NCC2
Synonyms:- 2,3-Dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-5-carboxaldehyde, 2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.