CymitQuimica logo

CAS 1060804-13-8

:

6-(2-Aminoethyl)-3-pyridinecarbonitrile

Description:
6-(2-Aminoethyl)-3-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the cyano group (-C≡N) at the 3-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The aminoethyl side chain at the 6-position introduces basic properties and enhances the compound's solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its behavior in different environments. Overall, 6-(2-Aminoethyl)-3-pyridinecarbonitrile is a versatile compound with potential utility in various fields of chemistry and pharmacology.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c9-4-3-8-2-1-7(5-10)6-11-8/h1-2,6H,3-4,9H2
InChI key:InChIKey=GMGRNUJWBKOMOW-UHFFFAOYSA-N
SMILES:C(CN)C1=CC=C(C#N)C=N1
Synonyms:
  • 3-Pyridinecarbonitrile, 6-(2-aminoethyl)-
  • 6-(2-Aminoethyl)-3-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.