CymitQuimica logo

CAS 1060804-27-4

:

5-Amino-N-methyl-2-pyridinemethanamine

Description:
5-Amino-N-methyl-2-pyridinemethanamine, identified by its CAS number 1060804-27-4, is an organic compound characterized by the presence of an amino group and a pyridine ring. This substance features a methyl group attached to the nitrogen atom of the amino group, which contributes to its basicity and potential reactivity. The pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, imparts unique electronic properties, making the compound useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of both amino and pyridine functionalities suggests that it may participate in hydrogen bonding and act as a ligand in coordination chemistry. Additionally, its solubility in polar solvents indicates potential for use in biological systems or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-9-5-7-3-2-6(8)4-10-7/h2-4,9H,5,8H2,1H3
InChI key:InChIKey=ZHPQBBSVQGNAPA-UHFFFAOYSA-N
SMILES:C(NC)C1=CC=C(N)C=N1
Synonyms:
  • 2-Pyridinemethanamine, 5-amino-N-methyl-
  • 5-Amino-N-methyl-2-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.