CAS 1060804-37-6

1-(3-Amino-4-pyridinyl)-2,2,2-trifluoroethanone

Description:

1-(3-Amino-4-pyridinyl)-2,2,2-trifluoroethanone, identified by its CAS number 1060804-37-6, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with an amino group and a trifluoroethanone moiety. This compound typically exhibits properties associated with both the pyridine and trifluoroethanone functional groups, such as potential basicity due to the amino group and reactivity due to the electrophilic nature of the trifluoroethanone. It may be soluble in polar organic solvents and could demonstrate moderate stability under standard conditions. The presence of fluorine atoms often imparts distinctive electronic properties, potentially influencing its reactivity and interactions with biological systems. Such compounds may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with their use.

Formula: C₇H₅F₃N₂O

InChI: InChI=1S/C7H5F3N2O/c8-7(9,10)6(13)4-1-2-12-3-5(4)11/h1-3H,11H2

InChI key: InChIKey=NTWYLYWJCOVQRC-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C=1C(N)=CN=CC1

Synonyms:

• Ethanone, 1-(3-amino-4-pyridinyl)-2,2,2-trifluoro-
• 1-(3-Amino-4-pyridinyl)-2,2,2-trifluoroethanone