
CAS 1060804-59-2
:N-Methyl-5-(phenylmethoxy)-2-pyridinemethanamine
Description:
N-Methyl-5-(phenylmethoxy)-2-pyridinemethanamine, identified by its CAS number 1060804-59-2, is a chemical compound that features a pyridine ring substituted with a methoxy group and an amine. This compound is characterized by its structural complexity, which includes a methyl group attached to the nitrogen atom and a phenylmethoxy group that enhances its lipophilicity. The presence of the pyridine moiety suggests potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The methoxy group can influence the compound's solubility and reactivity, while the amine functionality may participate in hydrogen bonding and other interactions. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing agents that target specific biological pathways or receptors. Its unique structure could also lend itself to applications in organic synthesis or as a building block for more complex molecules.
Formula:C14H16N2O
InChI:InChI=1S/C14H16N2O/c1-15-9-13-7-8-14(10-16-13)17-11-12-5-3-2-4-6-12/h2-8,10,15H,9,11H2,1H3
InChI key:InChIKey=VPAIRBQZGYSZBA-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=CC(CNC)=NC2
Synonyms:- 2-Pyridinemethanamine, N-methyl-5-(phenylmethoxy)-
- N-Methyl-5-(phenylmethoxy)-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.