CAS 1060804-65-0

2,2,2-Trifluoro-1-(3-hydroxy-4-pyridinyl)ethanone

Description:

2,2,2-Trifluoro-1-(3-hydroxy-4-pyridinyl)ethanone is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a pyridine derivative. This compound features a ketone functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydroxyl group on the pyridine ring can participate in hydrogen bonding, affecting solubility and interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological effects would depend on further empirical studies. Its molecular structure suggests potential utility in the development of pharmaceuticals or agrochemicals. As with many fluorinated compounds, it may also exhibit stability against metabolic degradation, which is a desirable trait in drug design. Safety and handling considerations should be taken into account due to the presence of fluorine, which can impart unique toxicological properties.

Formula: C₇H₄F₃NO₂

InChI: InChI=1S/C7H4F3NO2/c8-7(9,10)6(13)4-1-2-11-3-5(4)12/h1-3,12H

InChI key: InChIKey=VKCJFQXKGHROMR-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C=1C(O)=CN=CC1

Synonyms:

• Ethanone, 2,2,2-trifluoro-1-(3-hydroxy-4-pyridinyl)-
• 2,2,2-Trifluoro-1-(3-hydroxy-4-pyridinyl)ethanone