CAS 1060804-85-4

1-(4-Methyl-2-pyridinyl)cyclopropanamine

Description:

1-(4-Methyl-2-pyridinyl)cyclopropanamine, identified by its CAS number 1060804-85-4, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety. The presence of the 4-methyl group on the pyridine ring contributes to its lipophilicity and potential biological activity. This compound is typically classified as an amine due to the presence of the amine functional group, which can participate in hydrogen bonding and influence its solubility in various solvents. The cyclopropane structure imparts strain, which can affect the reactivity and stability of the compound. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions with biological targets would depend on its conformation and the electronic effects of the substituents. Overall, 1-(4-Methyl-2-pyridinyl)cyclopropanamine represents a class of compounds that may have applications in therapeutic contexts, warranting further investigation into its properties and potential uses.

Formula: C₉H₁₂N₂

InChI: InChI=1S/C9H12N2/c1-7-2-5-11-8(6-7)9(10)3-4-9/h2,5-6H,3-4,10H2,1H3

InChI key: InChIKey=VGSUYRTZXNNGAQ-UHFFFAOYSA-N

SMILES: NC1(CC1)C2=CC(C)=CC=N2

Synonyms:

• 1-(4-Methyl-2-pyridinyl)cyclopropanamine
• Cyclopropanamine, 1-(4-methyl-2-pyridinyl)-